CAS 1090903-90-4 appears in our catalog under these names: METHYL 6-METHYL-1H-INDOLE-4-CARBOXYLATE, 97%, Methyl 6‐methyl‐1h‐indole‐4‐carboxylate, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 6-methyl-1H-indole-4-carboxylate (CAS 1090903-90-4) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 6-methyl-1H-indole-4-carboxylate. InChIKey: HNXFVUFQRGWNEA-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl 6-methyl-1H-indole-4-carboxylate |
| InChIKey | HNXFVUFQRGWNEA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=CNC2=C1)C(=O)OC |
Computed by PubChem (NCBI)