Products 109133-94-0
CAS 109133-94-0 is the registry number for Carbamic acid, N-[2-formyl-5-(trifluoromethyl)phenyl]-, 1,1-dimethylethyl ester, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[2-formyl-5-(trifluoromethyl)phenyl]carbamate (CAS 109133-94-0) is a chemical compound with the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. IUPAC name: tert-butyl N-[2-formyl-5-(trifluoromethyl)phenyl]carbamate. InChIKey: MSXXNEGBVGHVFB-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | tert-butyl N-[2-formyl-5-(trifluoromethyl)phenyl]carbamate |
| InChIKey | MSXXNEGBVGHVFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)