CAS 1391554-42-9 is the registry number for Sitagliptin Impurity 115. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3S)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate (CAS 1391554-42-9) is a chemical compound with the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. IUPAC name: methyl (3S)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate. InChIKey: BBGGHUOAAZMMET-VIFPVBQESA-N.
| Molecular formula | C13H14F3NO3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | methyl (3S)-3-acetamido-4-(2,4,5-trifluorophenyl)butanoate |
| InChIKey | BBGGHUOAAZMMET-VIFPVBQESA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC(=C(C=C1F)F)F)CC(=O)OC |
Computed by PubChem (NCBI)