Products 212696-38-3
CAS 212696-38-3 is the registry number for tert-Butyl 2-formyl-4-(trifluoromethyl)phenylcarbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
Tert-butyl N-[2-formyl-4-(trifluoromethyl)phenyl]carbamate (CAS 212696-38-3) is a chemical compound with the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. IUPAC name: tert-butyl N-[2-formyl-4-(trifluoromethyl)phenyl]carbamate. InChIKey: ZXKOJSCHGAKGQH-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | tert-butyl N-[2-formyl-4-(trifluoromethyl)phenyl]carbamate |
| InChIKey | ZXKOJSCHGAKGQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)