Products 1440965-37-6
CAS 1440965-37-6 appears in our catalog under these names: ethyl 2–(4–acetamido–2–fluoro–5–methylphenyl)–2，2–difluoroacetate, Ethyl 2-(4-acetamido-2-fluoro-5-methylphenyl)-2,2-difluoroacetate. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 5g.
Ethyl 2-(4-acetamido-2-fluoro-5-methylphenyl)-2,2-difluoroacetate (CAS 1440965-37-6) is a chemical compound with the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. IUPAC name: ethyl 2-(4-acetamido-2-fluoro-5-methylphenyl)-2,2-difluoroacetate. InChIKey: QKHCRCMUSZLTQJ-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO3 |
|---|---|
| Molecular weight | 289.25 g/mol |
| IUPAC name | ethyl 2-(4-acetamido-2-fluoro-5-methylphenyl)-2,2-difluoroacetate |
| InChIKey | QKHCRCMUSZLTQJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=C(C(=C1)C)NC(=O)C)F)(F)F |
Computed by PubChem (NCBI)