CAS 109143-64-8 is the registry number for 6-Amino-5-nitrochromen-2-one. Offered by: TRC. Available pack sizes: 100mg.
6-amino-5-nitrochromen-2-one (CAS 109143-64-8) is a chemical compound with the molecular formula C9H6N2O4 and a molecular weight of 206.15 g/mol. IUPAC name: 6-amino-5-nitrochromen-2-one. InChIKey: UJQBMMXSOMEAJG-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O4 |
|---|---|
| Molecular weight | 206.15 g/mol |
| IUPAC name | 6-amino-5-nitrochromen-2-one |
| InChIKey | UJQBMMXSOMEAJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C1C(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)