CAS 1091605-42-3 appears in our catalog under these names: trans-Benzyl 3-hydroxy-2-(2-oxopropyl)piperidine-1-carboxylate, 97%, Halofuginone Impurity 1, trans-N-Benzyloxycarbonyl 3-Hydroxy-2-(2-oxopropyl)piperidine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 2mg, 5mg.
Benzyl (2R,3S)-3-hydroxy-2-(2-oxopropyl)piperidine-1-carboxylate (CAS 1091605-42-3) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: benzyl (2R,3S)-3-hydroxy-2-(2-oxopropyl)piperidine-1-carboxylate. InChIKey: QMZQCUOKMRKTCQ-CABCVRRESA-N.
| Molecular formula | C16H21NO4 |
|---|---|
| Molecular weight | 291.34 g/mol |
| IUPAC name | benzyl (2R,3S)-3-hydroxy-2-(2-oxopropyl)piperidine-1-carboxylate |
| InChIKey | QMZQCUOKMRKTCQ-CABCVRRESA-N |
| SMILES | CC(=O)C[C@@H]1[C@H](CCCN1C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)