CAS 1091611-71-0 appears in our catalog under these names: tert-Butyl 3-(cyanomethyl)benzoate, 98%, tert-Butyl 3-(cyanomethyl)benzoate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g, 2.5g.
Tert-butyl 3-(cyanomethyl)benzoate (CAS 1091611-71-0) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl 3-(cyanomethyl)benzoate. InChIKey: ISRHBTFZRBKPSN-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl 3-(cyanomethyl)benzoate |
| InChIKey | ISRHBTFZRBKPSN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC(=C1)CC#N |
Computed by PubChem (NCBI)