CAS 1091627-43-8 appears in our catalog under these names: 1-(Naphthalen-1-yl)ethan-1-amine, 98%, 1-(1-Naphthyl)ethylamine-d3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 50mg, 5mg, 5 mg, 50 mg.
2,2,2-trideuterio-1-naphthalen-1-ylethanamine (CAS 1091627-43-8) is a chemical compound with the molecular formula C12H13N and a molecular weight of 174.26 g/mol. IUPAC name: 2,2,2-trideuterio-1-naphthalen-1-ylethanamine. InChIKey: RTCUCQWIICFPOD-FIBGUPNXSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 174.26 g/mol |
| IUPAC name | 2,2,2-trideuterio-1-naphthalen-1-ylethanamine |
| InChIKey | RTCUCQWIICFPOD-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC=CC2=CC=CC=C21)N |
Computed by PubChem (NCBI)