Products 109217-14-3
CAS 109217-14-3 is the registry number for cis-11,12-Epoxy-14(Z)-eicosenoic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5-nitroquinolin-8-yl) 2-(2-methoxyethoxy)acetate (CAS 109217-14-3) is a chemical compound with the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. IUPAC name: (5-nitroquinolin-8-yl) 2-(2-methoxyethoxy)acetate. InChIKey: SVMVEOVICKEWQI-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O6 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | (5-nitroquinolin-8-yl) 2-(2-methoxyethoxy)acetate |
| InChIKey | SVMVEOVICKEWQI-UHFFFAOYSA-N |
| SMILES | COCCOCC(=O)OC1=C2C(=C(C=C1)[N+](=O)[O-])C=CC=N2 |
Computed by PubChem (NCBI)