CAS 76079-01-1 is the registry number for FA-Ala-OSu. Offered by: Creative Peptides. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoate (CAS 76079-01-1) is a chemical compound with the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoate. InChIKey: GBWLISUHPZYUSV-MOVJSRMASA-N.
| Molecular formula | C14H14N2O6 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) (2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoate |
| InChIKey | GBWLISUHPZYUSV-MOVJSRMASA-N |
| SMILES | C[C@@H](C(=O)ON1C(=O)CCC1=O)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)