Products 1221723-94-9
CAS 1221723-94-9 is the registry number for 3-(4-(2-Hydroxyethyl)-3-(methoxycarbonyl)-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-[4-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-4H-pyrazol-1-yl]benzoic acid (CAS 1221723-94-9) is a chemical compound with the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. IUPAC name: 3-[4-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-4H-pyrazol-1-yl]benzoic acid. InChIKey: WVVUOEBXRJPTLL-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O6 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 3-[4-(2-hydroxyethyl)-3-methoxycarbonyl-5-oxo-4H-pyrazol-1-yl]benzoic acid |
| InChIKey | WVVUOEBXRJPTLL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=O)C1CCO)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)