Products 1616500-54-9
CAS 1616500-54-9 is the registry number for 1-(3,5-Dimethoxyphenyl)-4-methoxy-6-oxo-1,6-dihydropyridazine-3-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3,5-dimethoxyphenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid (CAS 1616500-54-9) is a chemical compound with the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. IUPAC name: 1-(3,5-dimethoxyphenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid. InChIKey: MHJSRORDUFLBEC-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O6 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 1-(3,5-dimethoxyphenyl)-4-methoxy-6-oxopyridazine-3-carboxylic acid |
| InChIKey | MHJSRORDUFLBEC-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)N2C(=O)C=C(C(=N2)C(=O)O)OC)OC |
Computed by PubChem (NCBI)