CAS 109230-81-1 is the registry number for 4-(2,2,3,3-Tetrafluoropropoxy)aniline hydrochloride. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
4-(2,2,3,3-tetrafluoropropoxy)aniline;hydrochloride (CAS 109230-81-1) is a chemical compound with the molecular formula C9H10ClF4NO and a molecular weight of 259.63 g/mol. IUPAC name: 4-(2,2,3,3-tetrafluoropropoxy)aniline;hydrochloride. InChIKey: YRSVSLXAVULJMD-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF4NO |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | 4-(2,2,3,3-tetrafluoropropoxy)aniline;hydrochloride |
| InChIKey | YRSVSLXAVULJMD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OCC(C(F)F)(F)F.Cl |
Computed by PubChem (NCBI)