CAS 2242682-71-7 is the registry number for (R)-1-(2-Fluoro-5-(trifluoromethoxy)phenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride (CAS 2242682-71-7) is a chemical compound with the molecular formula C9H10ClF4NO and a molecular weight of 259.63 g/mol. IUPAC name: (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride. InChIKey: IISBHVSXQSOJCN-NUBCRITNSA-N.
| Molecular formula | C9H10ClF4NO |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | (1R)-1-[2-fluoro-5-(trifluoromethoxy)phenyl]ethanamine;hydrochloride |
| InChIKey | IISBHVSXQSOJCN-NUBCRITNSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)OC(F)(F)F)F)N.Cl |
Computed by PubChem (NCBI)