CAS 2931878-49-6 is the registry number for 2,2,2-Trifluoro-1-(4-fluoro-3-methoxyphenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine;hydrochloride (CAS 2931878-49-6) is a chemical compound with the molecular formula C9H10ClF4NO and a molecular weight of 259.63 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine;hydrochloride. InChIKey: RBDPKPDZCDDNGA-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF4NO |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-fluoro-3-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | RBDPKPDZCDDNGA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(C(F)(F)F)N)F.Cl |
Computed by PubChem (NCBI)