Products 2365419-05-0
CAS 2365419-05-0 is the registry number for 3-Fluoro-4-(2,2,2-trifluoro-ethoxy)-benzylamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methanamine;hydrochloride (CAS 2365419-05-0) is a chemical compound with the molecular formula C9H10ClF4NO and a molecular weight of 259.63 g/mol. IUPAC name: [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methanamine;hydrochloride. InChIKey: WJZJPPKKYQMMJS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClF4NO |
|---|---|
| Molecular weight | 259.63 g/mol |
| IUPAC name | [3-fluoro-4-(2,2,2-trifluoroethoxy)phenyl]methanamine;hydrochloride |
| InChIKey | WJZJPPKKYQMMJS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CN)F)OCC(F)(F)F.Cl |
Computed by PubChem (NCBI)