Products 1092400-79-7
CAS 1092400-79-7 appears in our catalog under these names: 4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid, 95%, 4-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 1092400-79-7) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: PXANEHZMXYKAPE-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | PXANEHZMXYKAPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=N2)CCl)C(=O)O |
Computed by PubChem (NCBI)