CAS 730976-58-6 is the registry number for 2-(Chloromethyl)-4-oxo-3,4-dihydroquinazoline-7-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylic acid (CAS 730976-58-6) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylic acid. InChIKey: LRLKSPKVLXAACO-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 2-(chloromethyl)-4-oxo-3H-quinazoline-7-carboxylic acid |
| InChIKey | LRLKSPKVLXAACO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)N=C(NC2=O)CCl |
Computed by PubChem (NCBI)