Products 39867-96-4
CAS 39867-96-4 appears in our catalog under these names: 4-(Chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole, 4-(Chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole (>90%), 4-(Chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole, 95%. Offered by: Biosynth, TRC, AmBeed. Available pack sizes: 0,5g, 50mg, 100mg, 10mg, 5g.
4-(chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole (CAS 39867-96-4) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 4-(chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole. InChIKey: JDNZYRXCPGOUJI-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 4-(chloromethyl)-2-(4-nitrophenyl)-1,3-oxazole |
| InChIKey | JDNZYRXCPGOUJI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CO2)CCl)[N+](=O)[O-] |
Computed by PubChem (NCBI)