Products 1092400-83-3
CAS 1092400-83-3 appears in our catalog under these names: 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid, 95%, 3-(5-(Chloromethyl)-1,2,4-oxadiazol-3-yl)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid (CAS 1092400-83-3) is a chemical compound with the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. IUPAC name: 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid. InChIKey: AANSZKTWZSNNQT-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O3 |
|---|---|
| Molecular weight | 238.63 g/mol |
| IUPAC name | 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]benzoic acid |
| InChIKey | AANSZKTWZSNNQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)