CAS 1092460-43-9 is the registry number for 4-Chloro-n-isobutylquinazoline-7-carboxamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
4-chloro-N-(2-methylpropyl)quinazoline-7-carboxamide (CAS 1092460-43-9) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 4-chloro-N-(2-methylpropyl)quinazoline-7-carboxamide. InChIKey: RDSAAJUNFLUVRV-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 4-chloro-N-(2-methylpropyl)quinazoline-7-carboxamide |
| InChIKey | RDSAAJUNFLUVRV-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)C1=CC2=C(C=C1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)