CAS 1311316-11-6 appears in our catalog under these names: 2-Chloro-N-{(2-(1H-pyrazol-1-ylmethyl)phenyl)methyl}acetamide, 95%, 2-Chloro-N-{(2-(1H-pyrazol-1-ylmethyl)phenyl)methyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-chloro-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide (CAS 1311316-11-6) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 2-chloro-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide. InChIKey: JLGUQNYQBHOLNH-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 2-chloro-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide |
| InChIKey | JLGUQNYQBHOLNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)CCl)CN2C=CC=N2 |
Computed by PubChem (NCBI)