Products 933191-57-2
CAS 933191-57-2 is the registry number for 3-(3-Chlorophenyl)-5-(piperidin-2-yl)-1,2,4-oxadiazole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chlorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole (CAS 933191-57-2) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 3-(3-chlorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole. InChIKey: BMIRHANAMYWREK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-5-piperidin-2-yl-1,2,4-oxadiazole |
| InChIKey | BMIRHANAMYWREK-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=NC(=NO2)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)