Products 1307296-61-2
CAS 1307296-61-2 is the registry number for Suvorexant Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-2-(7-methyl-2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-1,3-benzoxazole (CAS 1307296-61-2) is a chemical compound with the molecular formula C13H14ClN3O and a molecular weight of 263.72 g/mol. IUPAC name: 5-chloro-2-(7-methyl-2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-1,3-benzoxazole. InChIKey: JXXIZQDUHZXATE-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN3O |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | 5-chloro-2-(7-methyl-2,3,5,6-tetrahydro-1,4-diazepin-4-yl)-1,3-benzoxazole |
| InChIKey | JXXIZQDUHZXATE-UHFFFAOYSA-N |
| SMILES | CC1=NCCN(CC1)C2=NC3=C(O2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)