Products 1092461-36-3

CAS 1092461-36-3 appears in our catalog under these names: 3-Bromo-5-(trifluoromethoxy)benzoyl chloride, 95%, 3-Bromo-5-(trifluoromethoxy)benzoyl chloride, 95%+, 3-Bromo-5-(trifluoromethoxy)benzoyl chloride, 95%+, 95%+. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-bromo-5-(trifluoromethoxy)benzoyl chloride (CAS 1092461-36-3) is a chemical compound with the molecular formula C8H3BrClF3O2 and a molecular weight of 303.46 g/mol. IUPAC name: 3-bromo-5-(trifluoromethoxy)benzoyl chloride. InChIKey: PRRWHYQCMQADHB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H3BrClF3O2
Molecular weight303.46 g/mol
IUPAC name3-bromo-5-(trifluoromethoxy)benzoyl chloride
InChIKeyPRRWHYQCMQADHB-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1OC(F)(F)F)Br)C(=O)Cl

Computed by PubChem (NCBI)