Products 2386483-96-9
CAS 2386483-96-9 is the registry number for 3-Bromo-4-chloro-5-(trifluoromethyl)benzoic acid, ≥98.8%. Offered by: Chemat. Available pack sizes: 1g.
3-bromo-4-chloro-5-(trifluoromethyl)benzoic acid (CAS 2386483-96-9) is a chemical compound with the molecular formula C8H3BrClF3O2 and a molecular weight of 303.46 g/mol. IUPAC name: 3-bromo-4-chloro-5-(trifluoromethyl)benzoic acid. InChIKey: LFWJANKPJZEQBH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O2 |
|---|---|
| Molecular weight | 303.46 g/mol |
| IUPAC name | 3-bromo-4-chloro-5-(trifluoromethyl)benzoic acid |
| InChIKey | LFWJANKPJZEQBH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Br)C(=O)O |
Computed by PubChem (NCBI)