CAS 2089650-81-5 appears in our catalog under these names: 5-Bromo-2-chloro-4-(trifluoromethyl)benzoic acid, 95%, 5-Bromo-2-chloro-4-(trifluoromethyl)benzoic acid, 98%, 5–BROMO–2–CHLORO–4–(TRIFLUOROMETHYL)BENZOIC ACID, 5-Bromo-2-chloro-4-(trifluoromethyl)benzoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
5-bromo-2-chloro-4-(trifluoromethyl)benzoic acid (CAS 2089650-81-5) is a chemical compound with the molecular formula C8H3BrClF3O2 and a molecular weight of 303.46 g/mol. IUPAC name: 5-bromo-2-chloro-4-(trifluoromethyl)benzoic acid. InChIKey: ZFOHGYAHOICPJE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O2 |
|---|---|
| Molecular weight | 303.46 g/mol |
| IUPAC name | 5-bromo-2-chloro-4-(trifluoromethyl)benzoic acid |
| InChIKey | ZFOHGYAHOICPJE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)