CAS 2092139-72-3 is the registry number for 4-Bromo-2-chloro-5-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
4-bromo-2-chloro-5-(trifluoromethyl)benzoic acid (CAS 2092139-72-3) is a chemical compound with the molecular formula C8H3BrClF3O2 and a molecular weight of 303.46 g/mol. IUPAC name: 4-bromo-2-chloro-5-(trifluoromethyl)benzoic acid. InChIKey: LNFBPFSPAYQADP-UHFFFAOYSA-N.
| Molecular formula | C8H3BrClF3O2 |
|---|---|
| Molecular weight | 303.46 g/mol |
| IUPAC name | 4-bromo-2-chloro-5-(trifluoromethyl)benzoic acid |
| InChIKey | LNFBPFSPAYQADP-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(F)(F)F)Br)Cl)C(=O)O |
Computed by PubChem (NCBI)