Products 1092555-02-6
CAS 1092555-02-6 is the registry number for Paxiphylline D. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
Methyl 2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-17-carboxylate (CAS 1092555-02-6) is a chemical compound with the molecular formula C23H29NO4 and a molecular weight of 383.5 g/mol. IUPAC name: methyl 2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-17-carboxylate. InChIKey: KGESJSJJGMUDSQ-UHFFFAOYSA-N.
| Molecular formula | C23H29NO4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | methyl 2,6-dimethyl-8-oxido-20-oxo-8-azoniahexacyclo[11.5.1.11,5.02,10.03,8.016,19]icosa-13(19),16-diene-17-carboxylate |
| InChIKey | KGESJSJJGMUDSQ-UHFFFAOYSA-N |
| SMILES | CC1C[N+]2(CC3CCC4=C5C(=C(CC56C3(C2CC1C6=O)C)C(=O)OC)CC4)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Paxiphylline D