CAS 1092568-85-8 is the registry number for Methyl 3-(5-(((dimethylamino)methylene)amino)pyrimidin-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-[5-(dimethylaminomethylideneamino)pyrimidin-2-yl]benzoate (CAS 1092568-85-8) is a chemical compound with the molecular formula C15H16N4O2 and a molecular weight of 284.31 g/mol. IUPAC name: methyl 3-[5-(dimethylaminomethylideneamino)pyrimidin-2-yl]benzoate. InChIKey: KOWWERGAHLHYAP-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O2 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | methyl 3-[5-(dimethylaminomethylideneamino)pyrimidin-2-yl]benzoate |
| InChIKey | KOWWERGAHLHYAP-UHFFFAOYSA-N |
| SMILES | CN(C)C=NC1=CN=C(N=C1)C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)