CAS 790270-81-4 is the registry number for 2-(3-Amino-1H-isoindol-1-ylidene)-2-cyano-N-(3-methoxypropyl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
(2Z)-2-(3-aminoisoindol-1-ylidene)-2-cyano-N-(3-methoxypropyl)acetamide (CAS 790270-81-4) is a chemical compound with the molecular formula C15H16N4O2 and a molecular weight of 284.31 g/mol. IUPAC name: (2Z)-2-(3-aminoisoindol-1-ylidene)-2-cyano-N-(3-methoxypropyl)acetamide. InChIKey: IUSSBMRDVCQHMR-SEYXRHQNSA-N.
| Molecular formula | C15H16N4O2 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (2Z)-2-(3-aminoisoindol-1-ylidene)-2-cyano-N-(3-methoxypropyl)acetamide |
| InChIKey | IUSSBMRDVCQHMR-SEYXRHQNSA-N |
| SMILES | COCCCNC(=O)/C(=C\1/C2=CC=CC=C2C(=N1)N)/C#N |
Computed by PubChem (NCBI)