CAS 2113694-50-9 is the registry number for 5-Benzylisophthalohydrazide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-benzylbenzene-1,3-dicarbohydrazide (CAS 2113694-50-9) is a chemical compound with the molecular formula C15H16N4O2 and a molecular weight of 284.31 g/mol. IUPAC name: 5-benzylbenzene-1,3-dicarbohydrazide. InChIKey: RMNPKAQAUOFXKG-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O2 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 5-benzylbenzene-1,3-dicarbohydrazide |
| InChIKey | RMNPKAQAUOFXKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=CC(=C2)C(=O)NN)C(=O)NN |
Computed by PubChem (NCBI)