Products 2766179-30-8
CAS 2766179-30-8 is the registry number for 1-(1,2,3,4-Tetrahydropyrazino[1,2-a]indol-7-yl)dihydropyrimidine-2,4(1H,3H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-yl)-1,3-diazinane-2,4-dione (CAS 2766179-30-8) is a chemical compound with the molecular formula C15H16N4O2 and a molecular weight of 284.31 g/mol. IUPAC name: 1-(1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-yl)-1,3-diazinane-2,4-dione. InChIKey: BBVXSGWTTDUHQQ-UHFFFAOYSA-N.
| Molecular formula | C15H16N4O2 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 1-(1,2,3,4-tetrahydropyrazino[1,2-a]indol-7-yl)-1,3-diazinane-2,4-dione |
| InChIKey | BBVXSGWTTDUHQQ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)C=C4N3CCNC4 |
Computed by PubChem (NCBI)