Products 1093107-71-1
CAS 1093107-71-1 is the registry number for 4-(3-Nitrophenyl)piperazine-1-carbaldehyde, 97%. Offered by: Chemat. Available pack sizes: 1g.
4-(3-nitrophenyl)piperazine-1-carbaldehyde (CAS 1093107-71-1) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: 4-(3-nitrophenyl)piperazine-1-carbaldehyde. InChIKey: KCEVDIQBKIKRGH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | 4-(3-nitrophenyl)piperazine-1-carbaldehyde |
| InChIKey | KCEVDIQBKIKRGH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C=O)C2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)