Products 109312-81-4
CAS 109312-81-4 appears in our catalog under these names: 3-(Methylphenylamino)benzoic acid, 95-<97%, 3-[methyl(phenyl)amino]benzoic acid, 97%, 97%, 3-(Methyl(phenyl)amino)benzoic acid, 97%. Offered by: Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
3-(N-methylanilino)benzoic acid (CAS 109312-81-4) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 3-(N-methylanilino)benzoic acid. InChIKey: GLNRLSBDDQMDBP-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 3-(N-methylanilino)benzoic acid |
| InChIKey | GLNRLSBDDQMDBP-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=CC=C1)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)