Products 109339-64-2
CAS 109339-64-2 appears in our catalog under these names: 4-Methylbenzophenone-d3, >95% (HPLC), (4-(Methyl-d3)phenyl)(phenyl)methanone. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 100 mg, 50 mg, 25 mg.
Phenyl-[4-(trideuteriomethyl)phenyl]methanone (CAS 109339-64-2) is a chemical compound with the molecular formula C14H12O and a molecular weight of 199.26 g/mol. IUPAC name: phenyl-[4-(trideuteriomethyl)phenyl]methanone. InChIKey: WXPWZZHELZEVPO-FIBGUPNXSA-N.
| Molecular formula | C14H12O |
|---|---|
| Molecular weight | 199.26 g/mol |
| IUPAC name | phenyl-[4-(trideuteriomethyl)phenyl]methanone |
| InChIKey | WXPWZZHELZEVPO-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)