CAS 1093860-45-7 appears in our catalog under these names: (1-Methyl-1H-indazol-3-yl)methylamine dihydrochloride, 97% , (1-methyl-1H-indazol-3-yl)methanamine dihydrochloride. Offered by: Thermo Scientific, Chemat. Available pack sizes: 250MG, 1g, 2mg, 10mg.
(1-methylindazol-3-yl)methanamine;dihydrochloride (CAS 1093860-45-7) is a chemical compound with the molecular formula C9H13Cl2N3 and a molecular weight of 234.12 g/mol. IUPAC name: (1-methylindazol-3-yl)methanamine;dihydrochloride. InChIKey: ZHWICCCSNYFLJY-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N3 |
|---|---|
| Molecular weight | 234.12 g/mol |
| IUPAC name | (1-methylindazol-3-yl)methanamine;dihydrochloride |
| InChIKey | ZHWICCCSNYFLJY-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)CN.Cl.Cl |
Computed by PubChem (NCBI)