Products 109386-70-1

CAS 109386-70-1 is the registry number for Azelastine Impurity 36. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 4-[(3-ethoxy-3-oxopropyl)-methylamino]butanoate (CAS 109386-70-1) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: ethyl 4-[(3-ethoxy-3-oxopropyl)-methylamino]butanoate. InChIKey: SNBBJBGQWHTTSI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H23NO4
Molecular weight245.32 g/mol
IUPAC nameethyl 4-[(3-ethoxy-3-oxopropyl)-methylamino]butanoate
InChIKeySNBBJBGQWHTTSI-UHFFFAOYSA-N
SMILESCCOC(=O)CCCN(C)CCC(=O)OCC

Computed by PubChem (NCBI)