Products 109402-03-1
CAS 109402-03-1 is the registry number for 3-Benzyl-3,8-diazabicyclooctane[3.2.1]-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride (CAS 109402-03-1) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: 3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride. InChIKey: VKDIEQYRKUUCMS-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione;hydrochloride |
| InChIKey | VKDIEQYRKUUCMS-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)N(C(=O)C1N2)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)