Products 1094102-82-5
CAS 1094102-82-5 appears in our catalog under these names: (S)-Naproxen-d3, (S)-Naproxen-d3, >95% (HPLC), Naproxen-d3. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 2,5mg, 25mg, 10mg, 50mg, 2.5 mg.
(2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoic acid (CAS 1094102-82-5) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 233.28 g/mol. IUPAC name: (2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoic acid. InChIKey: CMWTZPSULFXXJA-IZTXOYSKSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 233.28 g/mol |
| IUPAC name | (2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoic acid |
| InChIKey | CMWTZPSULFXXJA-IZTXOYSKSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)[C@H](C)C(=O)O |
Computed by PubChem (NCBI)