Products 1261392-52-2
CAS 1261392-52-2 is the registry number for (±)-Naproxen-13C,d3. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2-[6-(trideuterio(113C)methoxy)naphthalen-2-yl]propanoic acid (CAS 1261392-52-2) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 234.27 g/mol. IUPAC name: 2-[6-(trideuterio(113C)methoxy)naphthalen-2-yl]propanoic acid. InChIKey: CMWTZPSULFXXJA-JVXUGDAPSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 2-[6-(trideuterio(113C)methoxy)naphthalen-2-yl]propanoic acid |
| InChIKey | CMWTZPSULFXXJA-JVXUGDAPSA-N |
| SMILES | [2H][13C]([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)C(C)C(=O)O |
Computed by PubChem (NCBI)