CAS 958293-77-1 appears in our catalog under these names: (±)-Naproxen-d3-1, (±)–Naproxen–d3, (+/-)-Naproxen D3, rac-Naproxen-d3 (alpha-methyl-d3), rac Naproxen-d3. Offered by: MedChemExpress, GLPBio, Chemat Brand, TRC, CDN. Available pack sizes: 500 μg, 1mg, on request, 10mg, 50mg, 0,05g, 0,01g, 500μg.
3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)propanoic acid (CAS 958293-77-1) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 233.28 g/mol. IUPAC name: 3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)propanoic acid. InChIKey: CMWTZPSULFXXJA-FIBGUPNXSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 233.28 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)propanoic acid |
| InChIKey | CMWTZPSULFXXJA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)