Products 1216704-11-8
CAS 1216704-11-8 appears in our catalog under these names: rac-Naproxen-13C,d3, >95% (HPLC), (±)-Naproxen-13C,d3-1. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)(313C)propanoic acid (CAS 1216704-11-8) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 234.27 g/mol. IUPAC name: 3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)(313C)propanoic acid. InChIKey: CMWTZPSULFXXJA-KQORAOOSSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 234.27 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-(6-methoxynaphthalen-2-yl)(313C)propanoic acid |
| InChIKey | CMWTZPSULFXXJA-KQORAOOSSA-N |
| SMILES | [2H][13C]([2H])([2H])C(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O |
Computed by PubChem (NCBI)