Products 1094238-17-1

CAS 1094238-17-1 appears in our catalog under these names: 2,6-Dichloro-3-(ethanesulfonyl)benzoic acid, 95%, 2,6-Dichloro-3-(ethanesulfonyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.

2,6-dichloro-3-ethylsulfonylbenzoic acid (CAS 1094238-17-1) is a chemical compound with the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. IUPAC name: 2,6-dichloro-3-ethylsulfonylbenzoic acid. InChIKey: LVACAZDHNAULKK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O4S
Molecular weight283.13 g/mol
IUPAC name2,6-dichloro-3-ethylsulfonylbenzoic acid
InChIKeyLVACAZDHNAULKK-UHFFFAOYSA-N
SMILESCCS(=O)(=O)C1=C(C(=C(C=C1)Cl)C(=O)O)Cl

Computed by PubChem (NCBI)