CAS 300700-03-2 is the registry number for [(3,4-Dichlorobenzyl)sulfonyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid (CAS 300700-03-2) is a chemical compound with the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid. InChIKey: GKJGKCRDFKGLBB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4S |
|---|---|
| Molecular weight | 283.13 g/mol |
| IUPAC name | 2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid |
| InChIKey | GKJGKCRDFKGLBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CS(=O)(=O)CC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)