Products 300700-03-2

CAS 300700-03-2 is the registry number for [(3,4-Dichlorobenzyl)sulfonyl]acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid (CAS 300700-03-2) is a chemical compound with the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. IUPAC name: 2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid. InChIKey: GKJGKCRDFKGLBB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Cl2O4S
Molecular weight283.13 g/mol
IUPAC name2-[(3,4-dichlorophenyl)methylsulfonyl]acetic acid
InChIKeyGKJGKCRDFKGLBB-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1CS(=O)(=O)CC(=O)O)Cl)Cl

Computed by PubChem (NCBI)