Products 2920080-82-4
CAS 2920080-82-4 is the registry number for Methyl 2-(5-chloro-2-(chlorosulfonyl)phenyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(5-chloro-2-chlorosulfonylphenyl)acetate (CAS 2920080-82-4) is a chemical compound with the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. IUPAC name: methyl 2-(5-chloro-2-chlorosulfonylphenyl)acetate. InChIKey: SAGUFDVYVUIGRP-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4S |
|---|---|
| Molecular weight | 283.13 g/mol |
| IUPAC name | methyl 2-(5-chloro-2-chlorosulfonylphenyl)acetate |
| InChIKey | SAGUFDVYVUIGRP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)