CAS 1155084-48-2 appears in our catalog under these names: Ethyl 3-chloro-5-(chlorosulfonyl)benzoate, 95%, Ethyl 3-chloro-5-(chlorosulfonyl)benzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Ethyl 3-chloro-5-chlorosulfonylbenzoate (CAS 1155084-48-2) is a chemical compound with the molecular formula C9H8Cl2O4S and a molecular weight of 283.13 g/mol. IUPAC name: ethyl 3-chloro-5-chlorosulfonylbenzoate. InChIKey: SUEZEBLIQMOCLB-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O4S |
|---|---|
| Molecular weight | 283.13 g/mol |
| IUPAC name | ethyl 3-chloro-5-chlorosulfonylbenzoate |
| InChIKey | SUEZEBLIQMOCLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)