CAS 1094284-48-6 appears in our catalog under these names: 1-(Prop-2-enoyl)-1,2,3,4-tetrahydroquinoline-6-carboxylic acid, 95%, 1-(Prop-2-enoyl)-1,2,3,4-tetrahydroquinoline-6-carboxylic Acid. Offered by: AmBeed, TRC, Biosynth. Available pack sizes: 1g, 500mg, 50mg, 0,5g.
1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxylic acid (CAS 1094284-48-6) is a chemical compound with the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. IUPAC name: 1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxylic acid. InChIKey: NKAGETFKNHKSIX-UHFFFAOYSA-N.
| Molecular formula | C13H13NO3 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 1-prop-2-enoyl-3,4-dihydro-2H-quinoline-6-carboxylic acid |
| InChIKey | NKAGETFKNHKSIX-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N1CCCC2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)