CAS 1094292-73-5 is the registry number for 6-Chloro-3-(2-methylcyclopropyl)-(1,2,4)triazolo(4,3-b)pyridazine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6-chloro-3-(2-methylcyclopropyl)-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1094292-73-5) is a chemical compound with the molecular formula C9H9ClN4 and a molecular weight of 208.65 g/mol. IUPAC name: 6-chloro-3-(2-methylcyclopropyl)-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: WQUSSIHFEIQPRI-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4 |
|---|---|
| Molecular weight | 208.65 g/mol |
| IUPAC name | 6-chloro-3-(2-methylcyclopropyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | WQUSSIHFEIQPRI-UHFFFAOYSA-N |
| SMILES | CC1CC1C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)